CAS 838-42-6 appears in our catalog under these names: 5,5-dimethyl-2-(4-nitrophenyl)-1,3-dioxane, 98%, 98%, 5,5-dimethyl-2-(4-nitrophenyl)-1,3-dioxane, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5,5-dimethyl-2-(4-nitrophenyl)-1,3-dioxane (CAS 838-42-6) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 5,5-dimethyl-2-(4-nitrophenyl)-1,3-dioxane. InChIKey: RZNYEPDJXZTRBD-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 5,5-dimethyl-2-(4-nitrophenyl)-1,3-dioxane |
| InChIKey | RZNYEPDJXZTRBD-UHFFFAOYSA-N |
| SMILES | CC1(COC(OC1)C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)