Products 83893-49-6
CAS 83893-49-6 is the registry number for Methyl 2-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate (CAS 83893-49-6) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: methyl 2-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate. InChIKey: XSECDPCETCTVLI-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | methyl 2-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
| InChIKey | XSECDPCETCTVLI-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=O)C(=CC1=O)Br)C(=O)OC |
Computed by PubChem (NCBI)