CAS 92-06-8 appears in our catalog under these names: m-Terphenyl, m-Terphenyl 99.5%, 1,1':3',1''-Terphenyl, 99.5%, 99.5%, m-Terphenyl, 99.99%, 1,1',3',1''-Terphenyl, 95%. Offered by: Dr. Ehrenstorfer, Ambeed, Chemat, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 1g, 5g, 25g, 100g, 500g, 10g, 25 g.
1,3-diphenylbenzene (CAS 92-06-8) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 1,3-diphenylbenzene. InChIKey: YJTKZCDBKVTVBY-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 1,3-diphenylbenzene |
| InChIKey | YJTKZCDBKVTVBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)