Products 17714-84-0
CAS 17714-84-0 appears in our catalog under these names: m-Terphenyl-d14, 98 atom % D, min 98% Chemical Purity, m-Terphenyl-d14. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1,2,3,4,5-pentadeuterio-6-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene (CAS 17714-84-0) is a chemical compound with the molecular formula C18H14 and a molecular weight of 244.4 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene. InChIKey: YJTKZCDBKVTVBY-WZAAGXFHSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 244.4 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene |
| InChIKey | YJTKZCDBKVTVBY-WZAAGXFHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)