CAS 34501-50-3 is the registry number for 10,11-Dihydrobenz(a)anthracene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
10,11-dihydrobenzo[a]anthracene (CAS 34501-50-3) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 10,11-dihydrobenzo[a]anthracene. InChIKey: CATLFKJMIAQVIW-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 10,11-dihydrobenzo[a]anthracene |
| InChIKey | CATLFKJMIAQVIW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C1)C=C3C=CC4=CC=CC=C4C3=C2 |
Computed by PubChem (NCBI)