Products 20496-16-6
CAS 20496-16-6 is the registry number for 3-Ethylfluoranthene. Offered by: TRC. Available pack sizes: 100mg.
3-ethylfluoranthene (CAS 20496-16-6) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 3-ethylfluoranthene. InChIKey: JXUOLJXLPIIRTP-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 3-ethylfluoranthene |
| InChIKey | JXUOLJXLPIIRTP-UHFFFAOYSA-N |
| SMILES | CCC1=C2C=CC=C3C2=C(C=C1)C4=CC=CC=C43 |
Computed by PubChem (NCBI)
Synonyms:
3-Ethylfluoranthene, Fluoranthene, 3-ethyl-