Products 7530-35-0
CAS 7530-35-0 is the registry number for Rasagiline Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3H-inden-1-yl)-1H-indene (CAS 7530-35-0) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 3-(3H-inden-1-yl)-1H-indene. InChIKey: WUCGLJIGGDJNCY-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 3-(3H-inden-1-yl)-1H-indene |
| InChIKey | WUCGLJIGGDJNCY-UHFFFAOYSA-N |
| SMILES | C1C=C(C2=CC=CC=C21)C3=CCC4=CC=CC=C43 |
Computed by PubChem (NCBI)
Synonyms:
3H,3'H-1,1'-biindene, 3,3'-Bi-1H-indene