CAS 84000-09-9 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(ethyl)amino)propanoic acid, 98%, Fmoc-N-Et-Ala-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(ethyl)amino)propanoic acid, 97%, 97%, N-Fmoc-N-ethyl-L-alanine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 84000-09-9) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: FIVAYWIQBITLAU-ZDUSSCGKSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | FIVAYWIQBITLAU-ZDUSSCGKSA-N |
| SMILES | CCN([C@@H](C)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)