Products 842137-54-6
CAS 842137-54-6 appears in our catalog under these names: Methyl 4-(4-(chloromethyl)-1,3-thiazol-2-yl)benzoate, Methyl 4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzoate, 98%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 2.5g, 5g.
Methyl 4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzoate (CAS 842137-54-6) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: methyl 4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzoate. InChIKey: HSIQBQCTBQYWJZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | methyl 4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzoate |
| InChIKey | HSIQBQCTBQYWJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)