CAS 845790-38-7 appears in our catalog under these names: 5-(3-Fluorophenyl)-5-oxopentanoic acid, 95%, 5-(3-Fluorophenyl)-5-oxovaleric acid, 95%+, 3-Fluoro-δ-oxobenzenepentanoic acid, 95%+. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
5-(3-fluorophenyl)-5-oxopentanoic acid (CAS 845790-38-7) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: 5-(3-fluorophenyl)-5-oxopentanoic acid. InChIKey: VMDBDUOSNLRJAG-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-5-oxopentanoic acid |
| InChIKey | VMDBDUOSNLRJAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)CCCC(=O)O |
Computed by PubChem (NCBI)