Products 84923-71-7
CAS 84923-71-7 appears in our catalog under these names: 5–Cyano–2–methoxybenzoic acid, 5-cyano-2-methoxybenzoic acid, 5-Cyano-2-methoxybenzoic acid 95%, 5-Cyano-2-methoxybenzoic acid, 98%, 98%, 5-Cyano-2-methoxybenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g.
5-cyano-2-methoxybenzoic acid (CAS 84923-71-7) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-cyano-2-methoxybenzoic acid. InChIKey: YZBRQGBGYGMYEO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-cyano-2-methoxybenzoic acid |
| InChIKey | YZBRQGBGYGMYEO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)