CAS 84948-17-4 appears in our catalog under these names: [1,1'-Biphenyl]-4,4'-diyl diacrylate, 97%, 97%, [1,1'-Biphenyl]-4,4'-diyl diacrylate, 98%, [1,1'-Biphenyl]-4,4'-diyl diacrylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
[4-(4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate (CAS 84948-17-4) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: [4-(4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate. InChIKey: OVCJXJDRQQBETG-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | [4-(4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate |
| InChIKey | OVCJXJDRQQBETG-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C=C |
Computed by PubChem (NCBI)