Products 85026-47-7
CAS 85026-47-7 appears in our catalog under these names: Lurasidone Impurity 70, Lurasidone Impurity 2, Lurasidone Impurity 19, exo-5,6-Oxi-2,3-Norbornanedicarboxamide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 750mg.
(1S,2R,6S,7R,8R,10S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (CAS 85026-47-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: (1S,2R,6S,7R,8R,10S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione. InChIKey: UJXPPCDJYRWSLC-GIDHVPLMSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (1S,2R,6S,7R,8R,10S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| InChIKey | UJXPPCDJYRWSLC-GIDHVPLMSA-N |
| SMILES | C1[C@@H]2[C@H]3[C@@H]([C@H]1[C@H]4[C@@H]2O4)C(=O)NC3=O |
Computed by PubChem (NCBI)