CAS 85118-25-8 appears in our catalog under these names: Citalopram Impurity 17, Escitalopram Impurity 12, 5-Carbamoylphthalide. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1g.
1-oxo-3H-2-benzofuran-5-carboxamide (CAS 85118-25-8) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 1-oxo-3H-2-benzofuran-5-carboxamide. InChIKey: VOWKISVRIBSFMO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-oxo-3H-2-benzofuran-5-carboxamide |
| InChIKey | VOWKISVRIBSFMO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C(=O)N)C(=O)O1 |
Computed by PubChem (NCBI)