Products 852633-82-0

CAS 852633-82-0 is the registry number for 4-Morpholinophenylglyoxal hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-(4-morpholin-4-ylphenyl)-2-oxoacetaldehyde;hydrate (CAS 852633-82-0) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-(4-morpholin-4-ylphenyl)-2-oxoacetaldehyde;hydrate. InChIKey: ZMIBVEQMLLIBKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO4
Molecular weight237.25 g/mol
IUPAC name2-(4-morpholin-4-ylphenyl)-2-oxoacetaldehyde;hydrate
InChIKeyZMIBVEQMLLIBKQ-UHFFFAOYSA-N
SMILESC1COCCN1C2=CC=C(C=C2)C(=O)C=O.O

Computed by PubChem (NCBI)