Products 854515-52-9
CAS 854515-52-9 appears in our catalog under these names: 6-Hydroxy-2-methylbenzofuran-3-carboxylic acid, 95%, 6-Hydroxy-2-methyl-3-benzofurancarboxylic Acid, 6-Hydroxy-2-methylbenzofuran-3-carboxylic acid 95%, 6-Hydroxy-2-methylbenzofuran-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
6-hydroxy-2-methyl-1-benzofuran-3-carboxylic acid (CAS 854515-52-9) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 6-hydroxy-2-methyl-1-benzofuran-3-carboxylic acid. InChIKey: JVELFLPOFDICQP-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-hydroxy-2-methyl-1-benzofuran-3-carboxylic acid |
| InChIKey | JVELFLPOFDICQP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)