Products 854778-30-6
CAS 854778-30-6 appears in our catalog under these names: 2-Chloro-3-methoxyphenylboronic Acid, 97%, 97%, (2-Chloro-3-methoxyphenyl)boronic acid, 97%, 2-Chloro-3-methoxyphenylboronic acid, 97%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g, 10g, 100mg, 100g.
(2-chloro-3-methoxyphenyl)boronic acid (CAS 854778-30-6) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: (2-chloro-3-methoxyphenyl)boronic acid. InChIKey: ZDWONVAXOXYOJK-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | (2-chloro-3-methoxyphenyl)boronic acid |
| InChIKey | ZDWONVAXOXYOJK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)Cl)(O)O |
Computed by PubChem (NCBI)