CAS 855154-21-1 is the registry number for Ropivacaine Impurity 21 HCl. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-(2,6-dimethylphenyl)pyridine-4-carboxamide;hydrochloride (CAS 855154-21-1) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: N-(2,6-dimethylphenyl)pyridine-4-carboxamide;hydrochloride. InChIKey: ZDROKFTULIIGPU-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)pyridine-4-carboxamide;hydrochloride |
| InChIKey | ZDROKFTULIIGPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=CC=NC=C2.Cl |
Computed by PubChem (NCBI)