CAS 2483-49-0 appears in our catalog under these names: Boc–Ala–ONp, BOC-ALA-ONP, >=96.0%, Boc-Ala-Onp, 98%, 98%, BOC-ALA-ONP, 98%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g.
(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 2483-49-0) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SUHFNHHZORGDFI-VIFPVBQESA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SUHFNHHZORGDFI-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)