Products 85567-43-7
CAS 85567-43-7 is the registry number for Methyl 3-hydroxyfuro(3,2-b)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-hydroxyfuro[3,2-b]pyridine-2-carboxylate (CAS 85567-43-7) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: methyl 3-hydroxyfuro[3,2-b]pyridine-2-carboxylate. InChIKey: BIMSZOTZTGCYEO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | methyl 3-hydroxyfuro[3,2-b]pyridine-2-carboxylate |
| InChIKey | BIMSZOTZTGCYEO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(O1)C=CC=N2)O |
Computed by PubChem (NCBI)