CAS 855715-09-2 is the registry number for 1-(4-Methylphenyl)-5-oxo-2-(thiophen-2-yl)pyrrolidine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-methylphenyl)-5-oxo-2-thiophen-2-ylpyrrolidine-3-carboxylic acid (CAS 855715-09-2) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 1-(4-methylphenyl)-5-oxo-2-thiophen-2-ylpyrrolidine-3-carboxylic acid. InChIKey: PRTGINCKDPPNSZ-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)-5-oxo-2-thiophen-2-ylpyrrolidine-3-carboxylic acid |
| InChIKey | PRTGINCKDPPNSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(C(CC2=O)C(=O)O)C3=CC=CS3 |
Computed by PubChem (NCBI)