CAS 85657-94-9 is the registry number for N-(3,5-Dimethoxyphenyl)-2,2,2-trifluoroacetamide. Offered by: Biosynth. Available pack sizes: 10kg.
N-(3,5-dimethoxyphenyl)-2,2,2-trifluoroacetamide (CAS 85657-94-9) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: N-(3,5-dimethoxyphenyl)-2,2,2-trifluoroacetamide. InChIKey: JBVIFDIYLLRZDA-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | N-(3,5-dimethoxyphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | JBVIFDIYLLRZDA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)NC(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)