CAS 857283-96-6 is the registry number for [4-(2-Methyl-1,3-thiazol-4-yl)phenyl]methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol (CAS 857283-96-6) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: [4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol. InChIKey: RJHSPNFHEAFWDW-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | [4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol |
| InChIKey | RJHSPNFHEAFWDW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)