CAS 857540-41-1 appears in our catalog under these names: 2-(Pyridin-2-yloxy)benzoic acid, 2-(Pyridin-2-yloxy)benzoic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
2-pyridin-2-yloxybenzoic acid (CAS 857540-41-1) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-pyridin-2-yloxybenzoic acid. InChIKey: CLVADGGXOXDLIW-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-pyridin-2-yloxybenzoic acid |
| InChIKey | CLVADGGXOXDLIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CC=CC=N2 |
Computed by PubChem (NCBI)