CAS 3264-88-8 appears in our catalog under these names: Benzylpenicillin sodium CP Impurity 4, Benzylpenicillenic acid, Benzylpenicillin CP Impurity I. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-benzyl-5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid (CAS 3264-88-8) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 2-[(2-benzyl-5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid. InChIKey: HKMIVRINPALWDY-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-[(2-benzyl-5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid |
| InChIKey | HKMIVRINPALWDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C(=O)O)N=CC1=C(OC(=N1)CC2=CC=CC=C2)O)S |
Computed by PubChem (NCBI)