CAS 85808-33-9 appears in our catalog under these names: DL-Homophenylalanine methyl ester hydrochloride, 98%, H-DL-HoPhe-OMe.HCl, 97%, Methyl 2–amino–4–phenylbutanoate hydrochloride, H-DL-HoPhe-OMe.HCl, 97%, 97%, DL-Homophenylalanine methyl ester hydrochloride, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 100mg, 10g.
Methyl 2-amino-4-phenylbutanoate;hydrochloride (CAS 85808-33-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl 2-amino-4-phenylbutanoate;hydrochloride. InChIKey: PZKOPSSMUBBHMM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl 2-amino-4-phenylbutanoate;hydrochloride |
| InChIKey | PZKOPSSMUBBHMM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)