CAS 858124-35-3 appears in our catalog under these names: methyl 4-bromo-3-formylbenzoate, Methyl 4-bromo-3-formylbenzoate 95%, Methyl 4-bromo-3-formylbenzoate, 95%, Methyl 4-bromo-3-formylbenzoate, 95%, 95%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 25g, 10g, 50g, 100mg, 250mg, 1g, 5g, 100g.
Methyl 4-bromo-3-formylbenzoate (CAS 858124-35-3) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 4-bromo-3-formylbenzoate. InChIKey: ZXGBVIJNXQHZNP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 4-bromo-3-formylbenzoate |
| InChIKey | ZXGBVIJNXQHZNP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)