Products 858792-85-5
CAS 858792-85-5 is the registry number for 5-Bromo-6-hydroxybenzofuran-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-hydroxy-1-benzofuran-3-one (CAS 858792-85-5) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 5-bromo-6-hydroxy-1-benzofuran-3-one. InChIKey: HVUDNMHZCPIEBD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 5-bromo-6-hydroxy-1-benzofuran-3-one |
| InChIKey | HVUDNMHZCPIEBD-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC(=C(C=C2O1)O)Br |
Computed by PubChem (NCBI)