CAS 86029-73-4 appears in our catalog under these names: 1-(2-Hydroxyphenyl)-2-nitropropene, 95%, 1-(2-Hydroxyphenyl)-2-nitropropene. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
2-[(Z)-2-nitroprop-1-enyl]phenol (CAS 86029-73-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-[(Z)-2-nitroprop-1-enyl]phenol. InChIKey: MHOBLCWGHYOAOS-SREVYHEPSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-[(Z)-2-nitroprop-1-enyl]phenol |
| InChIKey | MHOBLCWGHYOAOS-SREVYHEPSA-N |
| SMILES | C/C(=C/C1=CC=CC=C1O)/[N+](=O)[O-] |
Computed by PubChem (NCBI)