CAS 860742-51-4 is the registry number for 4-Chloro-o-acetophenetide. Offered by: TRC. Available pack sizes: 1g.
N-(4-chloro-2-ethoxyphenyl)acetamide (CAS 860742-51-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: N-(4-chloro-2-ethoxyphenyl)acetamide. InChIKey: HVJQMYZZVGKTME-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | N-(4-chloro-2-ethoxyphenyl)acetamide |
| InChIKey | HVJQMYZZVGKTME-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)Cl)NC(=O)C |
Computed by PubChem (NCBI)