Products 861451-21-0

CAS 861451-21-0 is the registry number for Methyl 2-methyl-2-(piperidin-4-yl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-methyl-2-piperidin-4-ylpropanoate;hydrochloride (CAS 861451-21-0) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: methyl 2-methyl-2-piperidin-4-ylpropanoate;hydrochloride. InChIKey: XJHHEUNCVXNNNO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC namemethyl 2-methyl-2-piperidin-4-ylpropanoate;hydrochloride
InChIKeyXJHHEUNCVXNNNO-UHFFFAOYSA-N
SMILESCC(C)(C1CCNCC1)C(=O)OC.Cl

Computed by PubChem (NCBI)