CAS 86153-25-5 appears in our catalog under these names: 7-Bromo-1h-indole-3-carboxylic acid, 95%, 7-Bromo-1H-indole-3-carboxylic acid, 1H-Indole-3-carboxylic acid, 7-bromo-, 97%, 97%, 1H-Indole-3-carboxylic acid, 7-bromo-, 97%,, 7-Bromo-1H-indole-3-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g.
7-bromo-1H-indole-3-carboxylic acid (CAS 86153-25-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-1H-indole-3-carboxylic acid. InChIKey: RMWZYIREGHRJOQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-1H-indole-3-carboxylic acid |
| InChIKey | RMWZYIREGHRJOQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C2C(=O)O |
Computed by PubChem (NCBI)