CAS 862507-33-3 appears in our catalog under these names: 2-(Propan-2-yloxy)pyridine-4-carboxylic acid, 95%, 2-isopropoxyisonicotinic acid, 2-Isopropoxyisonicotinic acid 98+%, 2-Isopropoxyisonicotinic acid, 98+%, 98+%, 2-(Propan-2-yloxy)pyridine-4-carboxylic acid, 98+%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 2,5g.
2-propan-2-yloxypyridine-4-carboxylic acid (CAS 862507-33-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-propan-2-yloxypyridine-4-carboxylic acid. InChIKey: WLKDRXHGHKKQGI-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-propan-2-yloxypyridine-4-carboxylic acid |
| InChIKey | WLKDRXHGHKKQGI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)