Products 86266-64-0
CAS 86266-64-0 appears in our catalog under these names: 3-(Benzylamino)propanoic acid hydrochloride, 96%, N-Benzyl-beta-alanine hydrochloride, 3-(Benzylamino)propanoic acid hydrochloride 95%, N-benzyl-beta-alanine hydrochloride, 95%, 95%, 3-(benzylamino)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100mg, 250mg.
3-(benzylamino)propanoic acid;hydrochloride (CAS 86266-64-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 3-(benzylamino)propanoic acid;hydrochloride. InChIKey: KVOYPZXQUFLMHX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 3-(benzylamino)propanoic acid;hydrochloride |
| InChIKey | KVOYPZXQUFLMHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCCC(=O)O.Cl |
Computed by PubChem (NCBI)