CAS 86358-32-9 is the registry number for Methyl 2,3-dioxo-3-phenylpropanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,3-dioxo-3-phenylpropanoate (CAS 86358-32-9) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 2,3-dioxo-3-phenylpropanoate. InChIKey: LLGMJHPMHFWMBF-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 2,3-dioxo-3-phenylpropanoate |
| InChIKey | LLGMJHPMHFWMBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)