Products 86358-32-9

CAS 86358-32-9 is the registry number for Methyl 2,3-dioxo-3-phenylpropanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,3-dioxo-3-phenylpropanoate (CAS 86358-32-9) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 2,3-dioxo-3-phenylpropanoate. InChIKey: LLGMJHPMHFWMBF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O4
Molecular weight192.17 g/mol
IUPAC namemethyl 2,3-dioxo-3-phenylpropanoate
InChIKeyLLGMJHPMHFWMBF-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)C(=O)C1=CC=CC=C1

Computed by PubChem (NCBI)