CAS 864263-95-6 is the registry number for 1-(2,4-Dichlorophenyl)cyclopropanamine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1-(2,4-dichlorophenyl)cyclopropan-1-amine (CAS 864263-95-6) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopropan-1-amine. InChIKey: ZLKHNVROXMHDBX-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopropan-1-amine |
| InChIKey | ZLKHNVROXMHDBX-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)