Products 865354-04-7

CAS 865354-04-7 is the registry number for 4-PHenylethynylphthalic dimethyl ester, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Dimethyl 4-(2-phenylethynyl)benzene-1,2-dicarboxylate (CAS 865354-04-7) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: dimethyl 4-(2-phenylethynyl)benzene-1,2-dicarboxylate. InChIKey: UIQDAPDTHCOARC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O4
Molecular weight294.3 g/mol
IUPAC namedimethyl 4-(2-phenylethynyl)benzene-1,2-dicarboxylate
InChIKeyUIQDAPDTHCOARC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C#CC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)