CAS 865354-04-7 is the registry number for 4-PHenylethynylphthalic dimethyl ester, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
Dimethyl 4-(2-phenylethynyl)benzene-1,2-dicarboxylate (CAS 865354-04-7) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: dimethyl 4-(2-phenylethynyl)benzene-1,2-dicarboxylate. InChIKey: UIQDAPDTHCOARC-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | dimethyl 4-(2-phenylethynyl)benzene-1,2-dicarboxylate |
| InChIKey | UIQDAPDTHCOARC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C#CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)