CAS 86819-50-3 is the registry number for Isopropyl 5-amino-2-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Propan-2-yl 5-amino-2-chlorobenzoate (CAS 86819-50-3) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: propan-2-yl 5-amino-2-chlorobenzoate. InChIKey: XEHDGJHIPJRFLH-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | propan-2-yl 5-amino-2-chlorobenzoate |
| InChIKey | XEHDGJHIPJRFLH-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=CC(=C1)N)Cl |
Computed by PubChem (NCBI)