Products 869631-34-5

CAS 869631-34-5 is the registry number for 2-Acetamino-2',4'-dimethoxybiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[2-(2,4-dimethoxyphenyl)phenyl]acetamide (CAS 869631-34-5) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: N-[2-(2,4-dimethoxyphenyl)phenyl]acetamide. InChIKey: ZQDSQYVQJPKLDY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO3
Molecular weight271.31 g/mol
IUPAC nameN-[2-(2,4-dimethoxyphenyl)phenyl]acetamide
InChIKeyZQDSQYVQJPKLDY-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=CC=C1C2=C(C=C(C=C2)OC)OC

Computed by PubChem (NCBI)