CAS 870693-15-5 appears in our catalog under these names: 4-Fluoro-7-hydroxy-3-methyl-2,3-dihydro-1H-inden-1-one, 95%, 4-Fluoro-7-hydroxy-3-methyl-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one (CAS 870693-15-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one. InChIKey: APMLKHHZAUIDJJ-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | APMLKHHZAUIDJJ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(C=CC(=C12)F)O |
Computed by PubChem (NCBI)