Products 870703-62-1
CAS 870703-62-1 appears in our catalog under these names: 1-(2,6-Dimethoxypyridin-3-yl)ethanone 97%, 1-(2,6-Dimethoxypyridin-3-yl)ethanone, ≥95%, 3-Acetyl-2,6-dimethoxypyridine, 96%, 3-Acetyl-2,6-dimethoxypyridine, 3-Acetyl-2,6-dimethoxypyridine, 97%, 97%. Offered by: Ambeed, Fluorochem, Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
1-(2,6-dimethoxy-3-pyridinyl)ethanone (CAS 870703-62-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-(2,6-dimethoxy-3-pyridinyl)ethanone. InChIKey: IVALWZXGBXJZPI-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-(2,6-dimethoxy-3-pyridinyl)ethanone |
| InChIKey | IVALWZXGBXJZPI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(C=C1)OC)OC |
Computed by PubChem (NCBI)