CAS 870777-17-6 appears in our catalog under these names: (2–Fluoro–6–isopropoxyphenyl)boronic acid, (2-Fluoro-6-isopropoxyphenyl)boronic acid, 98%, (2-Fluoro-6-isopropoxyphenyl)boronic acid, 95%, (2-Fluoro-6-isopropoxyphenyl)boronic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
(2-fluoro-6-propan-2-yloxyphenyl)boronic acid (CAS 870777-17-6) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (2-fluoro-6-propan-2-yloxyphenyl)boronic acid. InChIKey: WVAMTUDWTJMGSG-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (2-fluoro-6-propan-2-yloxyphenyl)boronic acid |
| InChIKey | WVAMTUDWTJMGSG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1F)OC(C)C)(O)O |
Computed by PubChem (NCBI)