CAS 87081-54-7 is the registry number for (2S,3S)–3–acetamido–2–hydroxy–4–oxo–4–phenylbutanoic acid. Offered by: GLPBio. Available pack sizes: 100g, 25g, 5g.
(2S,3S)-3-acetamido-2-hydroxy-4-oxo-4-phenylbutanoic acid (CAS 87081-54-7) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (2S,3S)-3-acetamido-2-hydroxy-4-oxo-4-phenylbutanoic acid. InChIKey: JRVRHJSMHHKUKE-KOLCDFICSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2S,3S)-3-acetamido-2-hydroxy-4-oxo-4-phenylbutanoic acid |
| InChIKey | JRVRHJSMHHKUKE-KOLCDFICSA-N |
| SMILES | CC(=O)N[C@@H]([C@@H](C(=O)O)O)C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)