Products 871326-47-5
CAS 871326-47-5 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)-1,3-thiazole-4-carboxylic acid, PTCA, 99.72%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 0,5g, 100 mg, 25 mg, 50 mg.
2-(2,6-dichlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 871326-47-5) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: YYHBRWFGFYTFHR-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | YYHBRWFGFYTFHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)