Products 871502-87-3
CAS 871502-87-3 appears in our catalog under these names: 4–Bromo–2–formylbenzoic acid, 4-Bromo-2-formylbenzoic acid, 4-Bromo-2-formylbenzoic acid 98%, 4-Bromo-2-formylbenzoic Acid, 97%, 97%, 4-BROMO-2-FORMYLBENZOIC ACID, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 25g, 10g.
4-bromo-2-formylbenzoic acid (CAS 871502-87-3) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 4-bromo-2-formylbenzoic acid. InChIKey: GHVFFWJIPXPVBE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 4-bromo-2-formylbenzoic acid |
| InChIKey | GHVFFWJIPXPVBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C=O)C(=O)O |
Computed by PubChem (NCBI)