CAS 871875-57-9 appears in our catalog under these names: Ephedrine Impurity 4, 1-(3-Hydroxyphenyl)-1,2-propanedione 2-Oxime. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2E)-2-hydroxyimino-1-(3-hydroxyphenyl)propan-1-one (CAS 871875-57-9) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: (2E)-2-hydroxyimino-1-(3-hydroxyphenyl)propan-1-one. InChIKey: PSKCSDOXABZRQX-UXBLZVDNSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (2E)-2-hydroxyimino-1-(3-hydroxyphenyl)propan-1-one |
| InChIKey | PSKCSDOXABZRQX-UXBLZVDNSA-N |
| SMILES | C/C(=N\O)/C(=O)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)