CAS 872602-70-5 appears in our catalog under these names: 4-(2-aminopropan-2-yl)benzoic acid hydrochloride, 98%, 98%, 4-(2-Aminopropan-2-yl)benzoic acid (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
4-(2-aminopropan-2-yl)benzoic acid;hydrochloride (CAS 872602-70-5) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 4-(2-aminopropan-2-yl)benzoic acid;hydrochloride. InChIKey: VPMPITFWUGZLKL-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 4-(2-aminopropan-2-yl)benzoic acid;hydrochloride |
| InChIKey | VPMPITFWUGZLKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)