CAS 874375-17-4 appears in our catalog under these names: 4-Bromo-7-methylisatin, 4-Bromo-7-methylisatin, 95%, 4-Bromo-7-methylindoline-2,3-dione 95+%, 4-Bromo-7-methylindoline-2,3-dione, 95+%, 95+%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 10g, 50g, 100g, 1g, 5g.
4-bromo-7-methyl-1H-indole-2,3-dione (CAS 874375-17-4) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 4-bromo-7-methyl-1H-indole-2,3-dione. InChIKey: VYPAAYCDBZXFOI-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 4-bromo-7-methyl-1H-indole-2,3-dione |
| InChIKey | VYPAAYCDBZXFOI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)