CAS 874804-09-8 appears in our catalog under these names: 3,5-Difluoro-2-methoxybenzamide, 95%, 3,5-Difluoro-2-methoxybenzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
3,5-difluoro-2-methoxybenzamide (CAS 874804-09-8) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 3,5-difluoro-2-methoxybenzamide. InChIKey: ZSWCUSLITGYYTG-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 3,5-difluoro-2-methoxybenzamide |
| InChIKey | ZSWCUSLITGYYTG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)F)C(=O)N |
Computed by PubChem (NCBI)