Products 874968-47-5
CAS 874968-47-5 is the registry number for Ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate (CAS 874968-47-5) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate. InChIKey: CEHATKSXJJTJFH-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate |
| InChIKey | CEHATKSXJJTJFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC2=C(C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)